CAS 1212353-38-2 is the registry number for (S)-2-Methyl-pyrrolidine tosylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-methylbenzenesulfonic acid;(2S)-2-methylpyrrolidine (CAS 1212353-38-2) is a chemical compound with the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(2S)-2-methylpyrrolidine. InChIKey: ZXYDRZKLQBDQTN-ZSCHJXSPSA-N.
| Molecular formula | C12H19NO3S |
|---|---|
| Molecular weight | 257.35 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(2S)-2-methylpyrrolidine |
| InChIKey | ZXYDRZKLQBDQTN-ZSCHJXSPSA-N |
| SMILES | C[C@H]1CCCN1.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)