Products 204387-55-3

CAS 204387-55-3 is the registry number for (R)-2-Methylpyrrolidine tosylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methylbenzenesulfonic acid;(2R)-2-methylpyrrolidine (CAS 204387-55-3) is a chemical compound with the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(2R)-2-methylpyrrolidine. InChIKey: ZXYDRZKLQBDQTN-QDXATWJZSA-N.

Identity
Molecular formulaC12H19NO3S
Molecular weight257.35 g/mol
IUPAC name4-methylbenzenesulfonic acid;(2R)-2-methylpyrrolidine
InChIKeyZXYDRZKLQBDQTN-QDXATWJZSA-N
SMILESC[C@@H]1CCCN1.CC1=CC=C(C=C1)S(=O)(=O)O

Computed by PubChem (NCBI)