CAS 1212415-10-5 is the registry number for (1S)-1-(4-(2-Methylpropoxy)phenyl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(1S)-1-[4-(2-methylpropoxy)phenyl]ethanol (CAS 1212415-10-5) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: (1S)-1-[4-(2-methylpropoxy)phenyl]ethanol. InChIKey: ISIRRYYGTXHVRQ-JTQLQIEISA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | (1S)-1-[4-(2-methylpropoxy)phenyl]ethanol |
| InChIKey | ISIRRYYGTXHVRQ-JTQLQIEISA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OCC(C)C)O |
Computed by PubChem (NCBI)