CAS 121277-71-2 is the registry number for 4-(Quinolin-2-yl)but-3-yn-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-quinolin-2-ylbut-3-yn-1-ol (CAS 121277-71-2) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 4-quinolin-2-ylbut-3-yn-1-ol. InChIKey: UJPQWEHDJAJEHR-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 4-quinolin-2-ylbut-3-yn-1-ol |
| InChIKey | UJPQWEHDJAJEHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C#CCCO |
Computed by PubChem (NCBI)