CAS 1212831-53-2 is the registry number for (R)-2-Amino-2-(2-chlorophenyl)ethanol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-2-(2-chlorophenyl)ethanol (CAS 1212831-53-2) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: (2R)-2-amino-2-(2-chlorophenyl)ethanol. InChIKey: HALZSHRJUMADMG-QMMMGPOBSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-chlorophenyl)ethanol |
| InChIKey | HALZSHRJUMADMG-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CO)N)Cl |
Computed by PubChem (NCBI)