CAS 1212831-96-3 appears in our catalog under these names: (R)-Cyclopropyl(4-methoxyphenyl)methanamine hydrochloride, 95%, (R)–Cyclopropyl(4–methoxyphenyl)methanamine hydrochloride. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(R)-cyclopropyl-(4-methoxyphenyl)methanamine;hydrochloride (CAS 1212831-96-3) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (R)-cyclopropyl-(4-methoxyphenyl)methanamine;hydrochloride. InChIKey: WNXIXBPARKOHLB-RFVHGSKJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (R)-cyclopropyl-(4-methoxyphenyl)methanamine;hydrochloride |
| InChIKey | WNXIXBPARKOHLB-RFVHGSKJSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H](C2CC2)N.Cl |
Computed by PubChem (NCBI)