Products 1212897-03-4
CAS 1212897-03-4 is the registry number for (R)-4-(1-Amino-2,2,2-trifluoroethyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1R)-1-amino-2,2,2-trifluoroethyl]benzoic acid (CAS 1212897-03-4) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 4-[(1R)-1-amino-2,2,2-trifluoroethyl]benzoic acid. InChIKey: XRHBXDPKZDBKBX-SSDOTTSWSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]benzoic acid |
| InChIKey | XRHBXDPKZDBKBX-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)