CAS 1212910-87-6 is the registry number for (S)-2,2,2-Trifluoro-1-(3-fluoro-5-methoxyphenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2,2-trifluoro-1-(3-fluoro-5-methoxyphenyl)ethanamine (CAS 1212910-87-6) is a chemical compound with the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(3-fluoro-5-methoxyphenyl)ethanamine. InChIKey: RGVKUPQFNQQXDG-QMMMGPOBSA-N.
| Molecular formula | C9H9F4NO |
|---|---|
| Molecular weight | 223.17 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(3-fluoro-5-methoxyphenyl)ethanamine |
| InChIKey | RGVKUPQFNQQXDG-QMMMGPOBSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@@H](C(F)(F)F)N)F |
Computed by PubChem (NCBI)