CAS 2597958-14-8 is the registry number for 2-(4-Aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol (CAS 2597958-14-8) is a chemical compound with the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. IUPAC name: 2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol. InChIKey: HNXSUOOXGYTUBB-UHFFFAOYSA-N.
| Molecular formula | C9H9F4NO |
|---|---|
| Molecular weight | 223.17 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol |
| InChIKey | HNXSUOOXGYTUBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)F)(C(F)F)O)N |
Computed by PubChem (NCBI)