CAS 1212950-47-4 is the registry number for (S)-1-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropan-1-amine (CAS 1212950-47-4) is a chemical compound with the molecular formula C12H13F6N and a molecular weight of 285.23 g/mol. IUPAC name: (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropan-1-amine. InChIKey: BBLUIQMRDMLDIA-JTQLQIEISA-N.
| Molecular formula | C12H13F6N |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropan-1-amine |
| InChIKey | BBLUIQMRDMLDIA-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)