CAS 1213423-86-9 is the registry number for (R)-1-(3,5-Bis(trifluoromethyl)phenyl)butan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[3,5-bis(trifluoromethyl)phenyl]butan-1-amine (CAS 1213423-86-9) is a chemical compound with the molecular formula C12H13F6N and a molecular weight of 285.23 g/mol. IUPAC name: (1R)-1-[3,5-bis(trifluoromethyl)phenyl]butan-1-amine. InChIKey: ZDHYDBMCTPGPGI-SNVBAGLBSA-N.
| Molecular formula | C12H13F6N |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | (1R)-1-[3,5-bis(trifluoromethyl)phenyl]butan-1-amine |
| InChIKey | ZDHYDBMCTPGPGI-SNVBAGLBSA-N |
| SMILES | CCC[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)