CAS 1213060-74-2 is the registry number for (2S)-2-(4-Methoxyphenyl) Azetidine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-methoxyphenyl)azetidine (CAS 1213060-74-2) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (2S)-2-(4-methoxyphenyl)azetidine. InChIKey: JGRQFXJWMOUDTP-JTQLQIEISA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (2S)-2-(4-methoxyphenyl)azetidine |
| InChIKey | JGRQFXJWMOUDTP-JTQLQIEISA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2CCN2 |
Computed by PubChem (NCBI)