Products 1213088-30-2
CAS 1213088-30-2 is the registry number for (S)-2-(2,4-Dimethylphenyl)-2-(methylamino)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2,4-dimethylphenyl)-2-(methylamino)ethanol (CAS 1213088-30-2) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (2S)-2-(2,4-dimethylphenyl)-2-(methylamino)ethanol. InChIKey: SNDWDMHUJMKROA-LLVKDONJSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (2S)-2-(2,4-dimethylphenyl)-2-(methylamino)ethanol |
| InChIKey | SNDWDMHUJMKROA-LLVKDONJSA-N |
| SMILES | CC1=CC(=C(C=C1)[C@@H](CO)NC)C |
Computed by PubChem (NCBI)