CAS 1213099-69-4 appears in our catalog under these names: (S)-1-Amino-2,3-dihydro-1h-indene-4-carbonitrile hydrochloride, 95%, (S)-1-Amino-2,3-dihydro-1H-indene-4-carbonitrile 97%, (S)-1-Amino-2,3-dihydro-1h-indene-4-carbonitrile hydrochloride, 97%, 97%, (S)-1-Amino-2,3-dihydro-1H-indene-4-carbonitrile, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile (CAS 1213099-69-4) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: (1S)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile. InChIKey: ICKYBHPNMIHUPQ-JTQLQIEISA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | (1S)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile |
| InChIKey | ICKYBHPNMIHUPQ-JTQLQIEISA-N |
| SMILES | C1CC2=C(C=CC=C2[C@H]1N)C#N |
Computed by PubChem (NCBI)