CAS 893762-15-7 is the registry number for 4-Amino-8-methylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
8-methylquinolin-4-amine (CAS 893762-15-7) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: 8-methylquinolin-4-amine. InChIKey: TVZPXEZTWRAIID-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | 8-methylquinolin-4-amine |
| InChIKey | TVZPXEZTWRAIID-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC=N2)N |
Computed by PubChem (NCBI)