CAS 1213101-96-2 is the registry number for (R)-7-Bromo-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-7-bromo-2,3-dihydro-1H-inden-1-amine (CAS 1213101-96-2) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: (1R)-7-bromo-2,3-dihydro-1H-inden-1-amine. InChIKey: AKVBYYMULNIGLH-MRVPVSSYSA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | (1R)-7-bromo-2,3-dihydro-1H-inden-1-amine |
| InChIKey | AKVBYYMULNIGLH-MRVPVSSYSA-N |
| SMILES | C1CC2=C([C@@H]1N)C(=CC=C2)Br |
Computed by PubChem (NCBI)