CAS 1213190-47-6 is the registry number for Boc-d-3-carbamoylphenylalanine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-3-(3-carbamoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1213190-47-6) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: (2R)-3-(3-carbamoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JCPCVUPCEXUFGD-LLVKDONJSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2R)-3-(3-carbamoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JCPCVUPCEXUFGD-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)