CAS 1213215-67-8 is the registry number for (S)-2-(3,5-Difluorophenyl)-2-(methylamino)ethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3,5-difluorophenyl)-2-(methylamino)ethanol (CAS 1213215-67-8) is a chemical compound with the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. IUPAC name: (2S)-2-(3,5-difluorophenyl)-2-(methylamino)ethanol. InChIKey: WATBZSCZMMJJGI-SECBINFHSA-N.
| Molecular formula | C9H11F2NO |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (2S)-2-(3,5-difluorophenyl)-2-(methylamino)ethanol |
| InChIKey | WATBZSCZMMJJGI-SECBINFHSA-N |
| SMILES | CN[C@H](CO)C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)