Products 1213251-45-6
CAS 1213251-45-6 appears in our catalog under these names: 1–Hydroxybisabola–2，10–dien–4–one, 1-Hydroxybisabola-2,10-dien-4-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(4R,5R)-4-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one (CAS 1213251-45-6) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (4R,5R)-4-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one. InChIKey: YDCNFZXDPQSPKG-LNSITVRQSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (4R,5R)-4-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one |
| InChIKey | YDCNFZXDPQSPKG-LNSITVRQSA-N |
| SMILES | CC1=C[C@@H]([C@H](CC1=O)[C@@H](C)CCC=C(C)C)O |
Computed by PubChem (NCBI)