CAS 1213399-59-7 is the registry number for (S)-6-Fluoro-4-methyl-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-fluoro-4-methyl-2,3-dihydro-1H-inden-1-amine (CAS 1213399-59-7) is a chemical compound with the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. IUPAC name: (1S)-6-fluoro-4-methyl-2,3-dihydro-1H-inden-1-amine. InChIKey: UBXRNRVDWIOOKP-JTQLQIEISA-N.
| Molecular formula | C10H12FN |
|---|---|
| Molecular weight | 165.21 g/mol |
| IUPAC name | (1S)-6-fluoro-4-methyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | UBXRNRVDWIOOKP-JTQLQIEISA-N |
| SMILES | CC1=CC(=CC2=C1CC[C@@H]2N)F |
Computed by PubChem (NCBI)