CAS 1213403-76-9 is the registry number for (S)-2-(2,4-Difluoro-5-nitrophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2,4-difluoro-5-nitrophenyl)pyrrolidine (CAS 1213403-76-9) is a chemical compound with the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. IUPAC name: (2S)-2-(2,4-difluoro-5-nitrophenyl)pyrrolidine. InChIKey: BQZNITCDQGBXJX-VIFPVBQESA-N.
| Molecular formula | C10H10F2N2O2 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | (2S)-2-(2,4-difluoro-5-nitrophenyl)pyrrolidine |
| InChIKey | BQZNITCDQGBXJX-VIFPVBQESA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C=C2F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)