CAS 2060591-43-5 is the registry number for 2,2-Difluoro-1',4',6',7'-tetrahydrospiro[cyclopropane-1,5'-indazole]-3'-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1',1'-difluorospiro[1,4,6,7-tetrahydroindazole-5,2'-cyclopropane]-3-carboxylic acid (CAS 2060591-43-5) is a chemical compound with the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. IUPAC name: 1',1'-difluorospiro[1,4,6,7-tetrahydroindazole-5,2'-cyclopropane]-3-carboxylic acid. InChIKey: WIUKQFAJZIBPRT-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O2 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 1',1'-difluorospiro[1,4,6,7-tetrahydroindazole-5,2'-cyclopropane]-3-carboxylic acid |
| InChIKey | WIUKQFAJZIBPRT-UHFFFAOYSA-N |
| SMILES | C1CC2(CC3=C1NN=C3C(=O)O)CC2(F)F |
Computed by PubChem (NCBI)