CAS 1213410-24-2 is the registry number for (S)-3-(Pyrrolidin-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2S)-pyrrolidin-2-yl]benzoic acid (CAS 1213410-24-2) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 3-[(2S)-pyrrolidin-2-yl]benzoic acid. InChIKey: QFVDUGCRHXDSRI-JTQLQIEISA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 3-[(2S)-pyrrolidin-2-yl]benzoic acid |
| InChIKey | QFVDUGCRHXDSRI-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)