CAS 1213465-25-8 is the registry number for (1S)-6-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1213465-25-8) is a chemical compound with the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. IUPAC name: (1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: WEVSXXAELLQXOQ-JTQLQIEISA-N.
| Molecular formula | C10H12FN |
|---|---|
| Molecular weight | 165.21 g/mol |
| IUPAC name | (1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | WEVSXXAELLQXOQ-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=C(C=C2)F)N |
Computed by PubChem (NCBI)