CAS 121347-31-7 is the registry number for Methoxamine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,5-dimethoxyphenyl)-2-hydroxyiminopropan-1-one (CAS 121347-31-7) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 1-(2,5-dimethoxyphenyl)-2-hydroxyiminopropan-1-one. InChIKey: CLMOUULSNFEJKR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1-(2,5-dimethoxyphenyl)-2-hydroxyiminopropan-1-one |
| InChIKey | CLMOUULSNFEJKR-UHFFFAOYSA-N |
| SMILES | CC(=NO)C(=O)C1=C(C=CC(=C1)OC)OC |
Computed by PubChem (NCBI)