CAS 1213496-32-2 is the registry number for (2R)-2-(4-fluorophenyl)piperazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R)-2-(4-fluorophenyl)piperazine (CAS 1213496-32-2) is a chemical compound with the molecular formula C10H13FN2 and a molecular weight of 180.22 g/mol. IUPAC name: (2R)-2-(4-fluorophenyl)piperazine. InChIKey: NZAKSEMIIIZYEM-JTQLQIEISA-N.
| Molecular formula | C10H13FN2 |
|---|---|
| Molecular weight | 180.22 g/mol |
| IUPAC name | (2R)-2-(4-fluorophenyl)piperazine |
| InChIKey | NZAKSEMIIIZYEM-JTQLQIEISA-N |
| SMILES | C1CN[C@@H](CN1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)