Products 1213546-32-7
CAS 1213546-32-7 is the registry number for (R)-2-(2-Bromo-5-methoxyphenyl)pyrrolidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(2-bromo-5-methoxyphenyl)pyrrolidine (CAS 1213546-32-7) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: (2R)-2-(2-bromo-5-methoxyphenyl)pyrrolidine. InChIKey: YGIHSRFFFWVFRQ-LLVKDONJSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | (2R)-2-(2-bromo-5-methoxyphenyl)pyrrolidine |
| InChIKey | YGIHSRFFFWVFRQ-LLVKDONJSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)[C@H]2CCCN2 |
Computed by PubChem (NCBI)