Products 1213667-79-8
CAS 1213667-79-8 is the registry number for (S)-4-Amino-4-(3,5-difluorophenyl)butan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-amino-4-(3,5-difluorophenyl)butan-1-ol (CAS 1213667-79-8) is a chemical compound with the molecular formula C10H13F2NO and a molecular weight of 201.21 g/mol. IUPAC name: (4S)-4-amino-4-(3,5-difluorophenyl)butan-1-ol. InChIKey: RRFWRUGQUYFUBQ-JTQLQIEISA-N.
| Molecular formula | C10H13F2NO |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | (4S)-4-amino-4-(3,5-difluorophenyl)butan-1-ol |
| InChIKey | RRFWRUGQUYFUBQ-JTQLQIEISA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@H](CCCO)N |
Computed by PubChem (NCBI)