CAS 169749-84-2 appears in our catalog under these names: 4-(tert-Butoxy)-2,5-difluoro-3-methylpyridine, 95%, 4-(tert-Butoxy)-2,5-difluoro-3-methylpyridine, 95+%, 4–(tert–Butoxy)–2,5–difluoro–3–methylpyridine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2,5-difluoro-3-methyl-4-[(2-methylpropan-2-yl)oxy]pyridine (CAS 169749-84-2) is a chemical compound with the molecular formula C10H13F2NO and a molecular weight of 201.21 g/mol. IUPAC name: 2,5-difluoro-3-methyl-4-[(2-methylpropan-2-yl)oxy]pyridine. InChIKey: HJSRNFGVNHDQLN-UHFFFAOYSA-N.
| Molecular formula | C10H13F2NO |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | 2,5-difluoro-3-methyl-4-[(2-methylpropan-2-yl)oxy]pyridine |
| InChIKey | HJSRNFGVNHDQLN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CN=C1F)F)OC(C)(C)C |
Computed by PubChem (NCBI)