Products 1213701-11-1
CAS 1213701-11-1 appears in our catalog under these names: Ac4ManNAz, 98%, 98%, Ac4ManNAz, 99.52%, Ac4ManNAz, 98%. Offered by: Chemat, MedChemExpress, Ambeed. Available pack sizes: 25mg, 10mg, 25 mg, 5 mg, 50 mg, 10 mg, 100 mg, 100mg.
[(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate (CAS 1213701-11-1) is a chemical compound with the molecular formula C16H22N4O10 and a molecular weight of 430.37 g/mol. IUPAC name: [(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate. InChIKey: HGMISDAXLUIXKM-ZIRHEVKLSA-N.
| Molecular formula | C16H22N4O10 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | [(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate |
| InChIKey | HGMISDAXLUIXKM-ZIRHEVKLSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
(alpha)-Ac4ManNAz, (|A)-Ac4ManNAz