CAS 1213848-30-6 is the registry number for (R)-2-Amino-2-(3,5-bis(trifluoromethyl)phenyl)ethanol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-[3,5-bis(trifluoromethyl)phenyl]ethanol (CAS 1213848-30-6) is a chemical compound with the molecular formula C10H9F6NO and a molecular weight of 273.17 g/mol. IUPAC name: (2R)-2-amino-2-[3,5-bis(trifluoromethyl)phenyl]ethanol. InChIKey: IKDVCMONKGAXHP-QMMMGPOBSA-N.
| Molecular formula | C10H9F6NO |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | (2R)-2-amino-2-[3,5-bis(trifluoromethyl)phenyl]ethanol |
| InChIKey | IKDVCMONKGAXHP-QMMMGPOBSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)[C@H](CO)N |
Computed by PubChem (NCBI)