Products 852392-17-7
CAS 852392-17-7 is the registry number for 2-Amino-1-(3,5-bis(trifluoromethyl)phenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-[3,5-bis(trifluoromethyl)phenyl]ethanol (CAS 852392-17-7) is a chemical compound with the molecular formula C10H9F6NO and a molecular weight of 273.17 g/mol. IUPAC name: 2-amino-1-[3,5-bis(trifluoromethyl)phenyl]ethanol. InChIKey: QEOWKUPKTNBURP-UHFFFAOYSA-N.
| Molecular formula | C10H9F6NO |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 2-amino-1-[3,5-bis(trifluoromethyl)phenyl]ethanol |
| InChIKey | QEOWKUPKTNBURP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(CN)O |
Computed by PubChem (NCBI)