CAS 1213899-46-7 is the registry number for (S)-3-Amino-5-hydroxyindane, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(3S)-3-amino-2,3-dihydro-1H-inden-5-ol (CAS 1213899-46-7) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (3S)-3-amino-2,3-dihydro-1H-inden-5-ol. InChIKey: MOUPGBDOLGDVNW-VIFPVBQESA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (3S)-3-amino-2,3-dihydro-1H-inden-5-ol |
| InChIKey | MOUPGBDOLGDVNW-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1N)C=C(C=C2)O |
Computed by PubChem (NCBI)