CAS 169105-01-5 appears in our catalog under these names: (R)-3-Aminoindan-5-ol, (R)-(-)-6-Hydroxy-1-aminoindan, 95%, (R)–(–)–1–Amino–6–hydroxyindan. Offered by: TRC, Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(3R)-3-amino-2,3-dihydro-1H-inden-5-ol (CAS 169105-01-5) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (3R)-3-amino-2,3-dihydro-1H-inden-5-ol. InChIKey: MOUPGBDOLGDVNW-SECBINFHSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (3R)-3-amino-2,3-dihydro-1H-inden-5-ol |
| InChIKey | MOUPGBDOLGDVNW-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=C(C=C2)O |
Computed by PubChem (NCBI)