CAS 1213909-80-8 is the registry number for (S)-1-(3,5-Difluorophenyl)butan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3,5-difluorophenyl)butan-1-amine (CAS 1213909-80-8) is a chemical compound with the molecular formula C10H13F2N and a molecular weight of 185.21 g/mol. IUPAC name: (1S)-1-(3,5-difluorophenyl)butan-1-amine. InChIKey: GBBJPRXGGARYPF-JTQLQIEISA-N.
| Molecular formula | C10H13F2N |
|---|---|
| Molecular weight | 185.21 g/mol |
| IUPAC name | (1S)-1-(3,5-difluorophenyl)butan-1-amine |
| InChIKey | GBBJPRXGGARYPF-JTQLQIEISA-N |
| SMILES | CCC[C@@H](C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)