CAS 1213910-82-7 is the registry number for (S)-1-(3,5-Difluorophenyl)pentan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3,5-difluorophenyl)pentan-1-amine (CAS 1213910-82-7) is a chemical compound with the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. IUPAC name: (1S)-1-(3,5-difluorophenyl)pentan-1-amine. InChIKey: IPNGITDBPJVOCE-NSHDSACASA-N.
| Molecular formula | C11H15F2N |
|---|---|
| Molecular weight | 199.24 g/mol |
| IUPAC name | (1S)-1-(3,5-difluorophenyl)pentan-1-amine |
| InChIKey | IPNGITDBPJVOCE-NSHDSACASA-N |
| SMILES | CCCC[C@@H](C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)