Products 1388122-83-5
CAS 1388122-83-5 is the registry number for (R)-1-(3,4-Difluorophenyl)-2,2-dimethylpropan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,4-difluorophenyl)-2,2-dimethylpropan-1-amine (CAS 1388122-83-5) is a chemical compound with the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. IUPAC name: (1R)-1-(3,4-difluorophenyl)-2,2-dimethylpropan-1-amine. InChIKey: MXOIOJVGGXADOL-JTQLQIEISA-N.
| Molecular formula | C11H15F2N |
|---|---|
| Molecular weight | 199.24 g/mol |
| IUPAC name | (1R)-1-(3,4-difluorophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | MXOIOJVGGXADOL-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@H](C1=CC(=C(C=C1)F)F)N |
Computed by PubChem (NCBI)