Products 1213928-56-3
CAS 1213928-56-3 is the registry number for (R)-1-(3-Fluoro-5-methylphenyl)butan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3-fluoro-5-methylphenyl)butan-1-amine (CAS 1213928-56-3) is a chemical compound with the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. IUPAC name: (1R)-1-(3-fluoro-5-methylphenyl)butan-1-amine. InChIKey: LXMUQPUZVWQGAX-LLVKDONJSA-N.
| Molecular formula | C11H16FN |
|---|---|
| Molecular weight | 181.25 g/mol |
| IUPAC name | (1R)-1-(3-fluoro-5-methylphenyl)butan-1-amine |
| InChIKey | LXMUQPUZVWQGAX-LLVKDONJSA-N |
| SMILES | CCC[C@H](C1=CC(=CC(=C1)C)F)N |
Computed by PubChem (NCBI)