CAS 1214090-45-5 is the registry number for 3-Amino-7-methyl-1,3-dihydro-2h-indol-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-amino-7-methyl-1,3-dihydroindol-2-one;hydrochloride (CAS 1214090-45-5) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 3-amino-7-methyl-1,3-dihydroindol-2-one;hydrochloride. InChIKey: BOABCGXXNTXFNI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 3-amino-7-methyl-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | BOABCGXXNTXFNI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(C(=O)N2)N.Cl |
Computed by PubChem (NCBI)