Products 1214104-79-6

CAS 1214104-79-6 is the registry number for 1-Benzhydrylpiperidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-benzhydrylpiperidine-2-carboxylic acid;hydrochloride (CAS 1214104-79-6) is a chemical compound with the molecular formula C19H22ClNO2 and a molecular weight of 331.8 g/mol. IUPAC name: 1-benzhydrylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: FYLWVUHZPFNCPO-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22ClNO2
Molecular weight331.8 g/mol
IUPAC name1-benzhydrylpiperidine-2-carboxylic acid;hydrochloride
InChIKeyFYLWVUHZPFNCPO-UHFFFAOYSA-N
SMILESC1CCN(C(C1)C(=O)O)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl

Computed by PubChem (NCBI)