CAS 1214104-79-6 is the registry number for 1-Benzhydrylpiperidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-benzhydrylpiperidine-2-carboxylic acid;hydrochloride (CAS 1214104-79-6) is a chemical compound with the molecular formula C19H22ClNO2 and a molecular weight of 331.8 g/mol. IUPAC name: 1-benzhydrylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: FYLWVUHZPFNCPO-UHFFFAOYSA-N.
| Molecular formula | C19H22ClNO2 |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 1-benzhydrylpiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | FYLWVUHZPFNCPO-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)