CAS 693285-72-2 is the registry number for Ethyl 4–chloro–6–(2,6–diethylphenyl)–2–methylnicotinate. Offered by: GLPBio. Available pack sizes: 100mg.
Ethyl 4-chloro-6-(2,6-diethylphenyl)-2-methylpyridine-3-carboxylate (CAS 693285-72-2) is a chemical compound with the molecular formula C19H22ClNO2 and a molecular weight of 331.8 g/mol. IUPAC name: ethyl 4-chloro-6-(2,6-diethylphenyl)-2-methylpyridine-3-carboxylate. InChIKey: PRSMJQAYZMLGIE-UHFFFAOYSA-N.
| Molecular formula | C19H22ClNO2 |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | ethyl 4-chloro-6-(2,6-diethylphenyl)-2-methylpyridine-3-carboxylate |
| InChIKey | PRSMJQAYZMLGIE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)C2=NC(=C(C(=C2)Cl)C(=O)OCC)C |
Computed by PubChem (NCBI)