CAS 1214114-26-7 is the registry number for (Rac)-HfLeu (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 25 mg, 100 mg, 10 mg.
2-amino-5,5,5-trifluoro-4-(trifluoromethyl)pentanoic acid;hydrochloride (CAS 1214114-26-7) is a chemical compound with the molecular formula C6H8ClF6NO2 and a molecular weight of 275.57 g/mol. IUPAC name: 2-amino-5,5,5-trifluoro-4-(trifluoromethyl)pentanoic acid;hydrochloride. InChIKey: QPUTYNRQCLMYHP-UHFFFAOYSA-N.
| Molecular formula | C6H8ClF6NO2 |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | 2-amino-5,5,5-trifluoro-4-(trifluoromethyl)pentanoic acid;hydrochloride |
| InChIKey | QPUTYNRQCLMYHP-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)N)C(C(F)(F)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)