CAS 180980-10-3 is the registry number for Methyl (S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoate;hydrochloride (CAS 180980-10-3) is a chemical compound with the molecular formula C6H8ClF6NO2 and a molecular weight of 275.57 g/mol. IUPAC name: methyl (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoate;hydrochloride. InChIKey: VPDJDWCROPWRGJ-DKWTVANSSA-N.
| Molecular formula | C6H8ClF6NO2 |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | methyl (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoate;hydrochloride |
| InChIKey | VPDJDWCROPWRGJ-DKWTVANSSA-N |
| SMILES | COC(=O)[C@H](C(C(F)(F)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)