CAS 1214272-52-2 is the registry number for tert-butyl (3R,4R)-3-azido-4-hydroxy-pyrrolidine-1-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R,4R)-3-azido-4-hydroxypyrrolidine-1-carboxylate (CAS 1214272-52-2) is a chemical compound with the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. IUPAC name: tert-butyl (3R,4R)-3-azido-4-hydroxypyrrolidine-1-carboxylate. InChIKey: CSWBTQKOSPXYIE-RNFRBKRXSA-N.
| Molecular formula | C9H16N4O3 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-azido-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | CSWBTQKOSPXYIE-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)