Products 93284-16-3

CAS 93284-16-3 appears in our catalog under these names: Dyphylline Impurity 2, Dyphylline Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2,3-dihydroxypropyl)-N-methyl-5-(methylamino)imidazole-4-carboxamide (CAS 93284-16-3) is a chemical compound with the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. IUPAC name: 3-(2,3-dihydroxypropyl)-N-methyl-5-(methylamino)imidazole-4-carboxamide. InChIKey: CJIFJXVHYJNUIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16N4O3
Molecular weight228.25 g/mol
IUPAC name3-(2,3-dihydroxypropyl)-N-methyl-5-(methylamino)imidazole-4-carboxamide
InChIKeyCJIFJXVHYJNUIQ-UHFFFAOYSA-N
SMILESCNC1=C(N(C=N1)CC(CO)O)C(=O)NC

Computed by PubChem (NCBI)