Products 1214283-78-9

CAS 1214283-78-9 is the registry number for 5-tert-butyl 1-prop-2-en-1-yl (2S)-2-aminopentanedioate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-O-tert-butyl 1-O-prop-2-enyl (2S)-2-aminopentanedioate;hydrochloride (CAS 1214283-78-9) is a chemical compound with the molecular formula C12H22ClNO4 and a molecular weight of 279.76 g/mol. IUPAC name: 5-O-tert-butyl 1-O-prop-2-enyl (2S)-2-aminopentanedioate;hydrochloride. InChIKey: KDXLQFSCMUQFLS-FVGYRXGTSA-N.

Identity
Molecular formulaC12H22ClNO4
Molecular weight279.76 g/mol
IUPAC name5-O-tert-butyl 1-O-prop-2-enyl (2S)-2-aminopentanedioate;hydrochloride
InChIKeyKDXLQFSCMUQFLS-FVGYRXGTSA-N
SMILESCC(C)(C)OC(=O)CC[C@@H](C(=O)OCC=C)N.Cl

Computed by PubChem (NCBI)