CAS 1214283-78-9 is the registry number for 5-tert-butyl 1-prop-2-en-1-yl (2S)-2-aminopentanedioate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-O-tert-butyl 1-O-prop-2-enyl (2S)-2-aminopentanedioate;hydrochloride (CAS 1214283-78-9) is a chemical compound with the molecular formula C12H22ClNO4 and a molecular weight of 279.76 g/mol. IUPAC name: 5-O-tert-butyl 1-O-prop-2-enyl (2S)-2-aminopentanedioate;hydrochloride. InChIKey: KDXLQFSCMUQFLS-FVGYRXGTSA-N.
| Molecular formula | C12H22ClNO4 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-prop-2-enyl (2S)-2-aminopentanedioate;hydrochloride |
| InChIKey | KDXLQFSCMUQFLS-FVGYRXGTSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)OCC=C)N.Cl |
Computed by PubChem (NCBI)