CAS 70579-74-7 is the registry number for Chloromethyl (2s,3s)-2-[(tert-butoxy)carbonyl]amino-3-methylpentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Chloromethyl (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 70579-74-7) is a chemical compound with the molecular formula C12H22ClNO4 and a molecular weight of 279.76 g/mol. IUPAC name: chloromethyl (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: VRIGUKQJHAWXGW-IUCAKERBSA-N.
| Molecular formula | C12H22ClNO4 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | chloromethyl (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | VRIGUKQJHAWXGW-IUCAKERBSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCCl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)