Products 1214326-97-2
CAS 1214326-97-2 is the registry number for 5-Bromo-6-(trifluoromethyl)pyridine-2-thiol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-(trifluoromethyl)-1H-pyridine-2-thione (CAS 1214326-97-2) is a chemical compound with the molecular formula C6H3BrF3NS and a molecular weight of 258.06 g/mol. IUPAC name: 5-bromo-6-(trifluoromethyl)-1H-pyridine-2-thione. InChIKey: UVQOVPALVLJLPP-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NS |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 5-bromo-6-(trifluoromethyl)-1H-pyridine-2-thione |
| InChIKey | UVQOVPALVLJLPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)NC(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)