Products 1214372-31-2
CAS 1214372-31-2 is the registry number for 3-Bromo-5-(trifluoromethyl)pyridine-2-thiol, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-bromo-5-(trifluoromethyl)-1H-pyridine-2-thione (CAS 1214372-31-2) is a chemical compound with the molecular formula C6H3BrF3NS and a molecular weight of 258.06 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)-1H-pyridine-2-thione. InChIKey: WYEUNHLQJJDINM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NS |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)-1H-pyridine-2-thione |
| InChIKey | WYEUNHLQJJDINM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=S)NC=C1C(F)(F)F)Br |
Computed by PubChem (NCBI)