Products 1214332-84-9
CAS 1214332-84-9 is the registry number for 2-Chloro-6-(difluoromethoxy)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-6-(difluoromethoxy)pyridine-4-carboxylic acid (CAS 1214332-84-9) is a chemical compound with the molecular formula C7H4ClF2NO3 and a molecular weight of 223.56 g/mol. IUPAC name: 2-chloro-6-(difluoromethoxy)pyridine-4-carboxylic acid. InChIKey: SPLZJTAUBSIWEH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO3 |
|---|---|
| Molecular weight | 223.56 g/mol |
| IUPAC name | 2-chloro-6-(difluoromethoxy)pyridine-4-carboxylic acid |
| InChIKey | SPLZJTAUBSIWEH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1OC(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)